C14H23ClN4O — CID 97093099
5-chloro-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]pyrimidin-2-amine (PubChem CID 97093099) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 5-chloro-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 97093099 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-chloro-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butyl]pyrimidin-2-amine |
| SMILES | C[C@@H]1CN(CCCCNc2ncc(Cl)cn2)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H23ClN4O/c1-11-9-19(10-12(2)20-11)6-4-3-5-16-14-17-7-13(15)8-18-14/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,16,17,18)/t11-,12-/m1/s1 |
| InChIKey | UGTMZEZIWGODSA-VXGBXAGGSA-N |
| XLogP | 2.43 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|