C17H25F3N2O3S — CID 96536322
N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butyl]-4-(trifluoromethylsulfonyl)aniline (PubChem CID 96536322) has the molecular formula C17H25F3N2O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butyl]-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butyl]-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 96536322 |
| Molecular Formula | C17H25F3N2O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butyl]-4-(trifluoromethylsulfonyl)aniline |
| SMILES | C[C@@H]1CN(CCCCNc2ccc(S(=O)(=O)C(F)(F)F)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H25F3N2O3S/c1-13-11-22(12-14(2)25-13)10-4-3-9-21-15-5-7-16(8-6-15)26(23,24)17(18,19)20/h5-8,13-14,21H,3-4,9-12H2,1-2H3/t13-,14+ |
| InChIKey | KSCVMEHHHAQEBS-OKILXGFUSA-N |
| XLogP | 3.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|