C16H22F3N3O3 — CID 112808868
N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-4-nitro-3-(trifluoromethyl)aniline (PubChem CID 112808868) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-4-nitro-3-(trifluoromethyl)aniline.
| Compound Name | N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-4-nitro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 112808868 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-4-nitro-3-(trifluoromethyl)aniline |
| SMILES | CC1CN(CCCNc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC(C)O1 |
| InChI | InChI=1S/C16H22F3N3O3/c1-11-9-21(10-12(2)25-11)7-3-6-20-13-4-5-15(22(23)24)14(8-13)16(17,18)19/h4-5,8,11-12,20H,3,6-7,9-10H2,1-2H3 |
| InChIKey | LFOJGRZHCPCFRC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|