About 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline
2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline (PubChem CID 95781581) has the molecular formula C15H21BrFN3O3
and a molecular weight of 390.25 g/mol. Its IUPAC name is 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline.
Molecular Properties
| Compound Name | 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline |
| PubChem CID | 95781581 |
| Molecular Formula | C15H21BrFN3O3 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline |
| SMILES | C[C@H]1CN(CCCNc2c(F)cc([N+](=O)[O-])cc2Br)C[C@H](C)O1 |
| InChI | InChI=1S/C15H21BrFN3O3/c1-10-8-19(9-11(2)23-10)5-3-4-18-15-13(16)6-12(20(21)22)7-14(15)17/h6-7,10-11,18H,3-5,8-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | CHPXJMWTGHSSDU-QWRGUYRKSA-N |
| XLogP | 3.41 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline?
The IUPAC name of 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline (CID 95781581) is 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline.
What is the SMILES notation for 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline?
The canonical SMILES for 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline is C[C@H]1CN(CCCNc2c(F)cc([N+](=O)[O-])cc2Br)C[C@H](C)O1.
What is the InChIKey of 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline?
The InChIKey is CHPXJMWTGHSSDU-QWRGUYRKSA-N. The full InChI is InChI=1S/C15H21BrFN3O3/c1-10-8-19(9-11(2)23-10)5-3-4-18-15-13(16)6-12(20(21)22)7-14(15)17/h6-7,10-11,18H,3-5,8-9H2,1-2H3/t10-,11-/m0/s1.
What are the key properties of 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline?
2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline has a molecular weight of 390.25 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]-6-fluoro-4-nitroaniline is sourced from PubChem (CID 95781581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).