C13H19F2N3O2 — CID 103828442
N-(2,6-difluoro-4-nitrophenyl)-N'-methyl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 103828442) has the molecular formula C13H19F2N3O2 and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(2,6-difluoro-4-nitrophenyl)-N'-methyl-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-(2,6-difluoro-4-nitrophenyl)-N'-methyl-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103828442 |
| Molecular Formula | C13H19F2N3O2 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-(2,6-difluoro-4-nitrophenyl)-N'-methyl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)N(C)CCCNc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H19F2N3O2/c1-9(2)17(3)6-4-5-16-13-11(14)7-10(18(19)20)8-12(13)15/h7-9,16H,4-6H2,1-3H3 |
| InChIKey | CQRNAONXLOJRQC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|