C13H17F2N3O3 — CID 103828577
N-tert-butyl-3-(2,6-difluoro-4-nitroanilino)propanamide (PubChem CID 103828577) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-tert-butyl-3-(2,6-difluoro-4-nitroanilino)propanamide.
| Compound Name | N-tert-butyl-3-(2,6-difluoro-4-nitroanilino)propanamide |
|---|---|
| PubChem CID | 103828577 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-tert-butyl-3-(2,6-difluoro-4-nitroanilino)propanamide |
| SMILES | CC(C)(C)NC(=O)CCNc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H17F2N3O3/c1-13(2,3)17-11(19)4-5-16-12-9(14)6-8(18(20)21)7-10(12)15/h6-7,16H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | ZFFWXMSZFREDDS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|