C10H10F2N2O5 — CID 114048045
2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid (PubChem CID 114048045) has the molecular formula C10H10F2N2O5 and a molecular weight of 276.19 g/mol. Its IUPAC name is 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid.
| Compound Name | 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 114048045 |
| Molecular Formula | C10H10F2N2O5 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H10F2N2O5/c11-7-3-6(14(17)18)4-8(12)10(7)13-1-2-19-5-9(15)16/h3-4,13H,1-2,5H2,(H,15,16) |
| InChIKey | DMSJRQPCFQFTSM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|