2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid

C10H10F2N2O5 — CID 114048045

IUPAC2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid
SMILESO=C(O)COCCNc1c(F)cc([N+](=O)[O-])cc1F
InChIInChI=1S/C10H10F2N2O5/c11-7-3-6(14(17)18)4-8(12)10(7)13-1-2-19-5-9(15)16/h3-4,13H,1-2,5H2,(H,15,16)
InChIKeyDMSJRQPCFQFTSM-UHFFFAOYSA-N
MW276.19 g/mol
LogP1.39
Rot. Bonds7

About 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid

2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid (PubChem CID 114048045) has the molecular formula C10H10F2N2O5 and a molecular weight of 276.19 g/mol. Its IUPAC name is 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid
PubChem CID114048045
Molecular FormulaC10H10F2N2O5
Molecular Weight276.19 g/mol
Exact Mass276.06
IUPAC Name2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid
SMILESO=C(O)COCCNc1c(F)cc([N+](=O)[O-])cc1F
InChIInChI=1S/C10H10F2N2O5/c11-7-3-6(14(17)18)4-8(12)10(7)13-1-2-19-5-9(15)16/h3-4,13H,1-2,5H2,(H,15,16)
InChIKeyDMSJRQPCFQFTSM-UHFFFAOYSA-N
XLogP1.39
TPSA101.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.19
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid?
The IUPAC name of 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid (CID 114048045) is 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid.
What is the SMILES notation for 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid?
The canonical SMILES for 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid is O=C(O)COCCNc1c(F)cc([N+](=O)[O-])cc1F.
What is the InChIKey of 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid?
The InChIKey is DMSJRQPCFQFTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2O5/c11-7-3-6(14(17)18)4-8(12)10(7)13-1-2-19-5-9(15)16/h3-4,13H,1-2,5H2,(H,15,16).
What are the key properties of 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid?
2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid has a molecular weight of 276.19 g/mol, XLogP of 1.39, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-difluoro-4-nitroanilino)ethoxy]acetic acid is sourced from PubChem (CID 114048045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).