C15H14F2N2O3 — CID 133434958
[4-[2-(2,6-difluoro-4-nitroanilino)ethyl]phenyl]methanol (PubChem CID 133434958) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is [4-[2-(2,6-difluoro-4-nitroanilino)ethyl]phenyl]methanol.
| Compound Name | [4-[2-(2,6-difluoro-4-nitroanilino)ethyl]phenyl]methanol |
|---|---|
| PubChem CID | 133434958 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [4-[2-(2,6-difluoro-4-nitroanilino)ethyl]phenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(F)c(NCCc2ccc(CO)cc2)c(F)c1 |
| InChI | InChI=1S/C15H14F2N2O3/c16-13-7-12(19(21)22)8-14(17)15(13)18-6-5-10-1-3-11(9-20)4-2-10/h1-4,7-8,18,20H,5-6,9H2 |
| InChIKey | JPEWNCHSEAIAFU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|