C10H8F2N2O4 — CID 114048043
1-(2,6-difluoro-4-nitroanilino)cyclopropane-1-carboxylic acid (PubChem CID 114048043) has the molecular formula C10H8F2N2O4 and a molecular weight of 258.18 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-nitroanilino)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(2,6-difluoro-4-nitroanilino)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 114048043 |
| Molecular Formula | C10H8F2N2O4 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-(2,6-difluoro-4-nitroanilino)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(Nc2c(F)cc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C10H8F2N2O4/c11-6-3-5(14(17)18)4-7(12)8(6)13-10(1-2-10)9(15)16/h3-4,13H,1-2H2,(H,15,16) |
| InChIKey | CLJONBQEOUROIK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|