C18H25F3N2O3 — CID 51953215
N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 51953215) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 51953215 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | C[C@@H]1CN(CCCNC(=O)Cc2ccc(OC(F)(F)F)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-13-11-23(12-14(2)25-13)9-3-8-22-17(24)10-15-4-6-16(7-5-15)26-18(19,20)21/h4-7,13-14H,3,8-12H2,1-2H3,(H,22,24)/t13-,14-/m1/s1 |
| InChIKey | REGWIKWHTDORLF-ZIAGYGMSSA-N |
| XLogP | 2.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|