C14H15F3N4O2 — CID 47040841
N-[3-(1,2,4-triazol-1-yl)propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 47040841) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is N-[3-(1,2,4-triazol-1-yl)propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[3-(1,2,4-triazol-1-yl)propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 47040841 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[3-(1,2,4-triazol-1-yl)propyl]-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NCCCn1cncn1 |
| InChI | InChI=1S/C14H15F3N4O2/c15-14(16,17)23-12-4-2-11(3-5-12)8-13(22)19-6-1-7-21-10-18-9-20-21/h2-5,9-10H,1,6-8H2,(H,19,22) |
| InChIKey | BPHLBBROPYKLTQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|