C13H22ClN3 — CID 107816307
5-chloro-N-(7-methyloctyl)pyrimidin-2-amine (PubChem CID 107816307) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 5-chloro-N-(7-methyloctyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-(7-methyloctyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107816307 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 5-chloro-N-(7-methyloctyl)pyrimidin-2-amine |
| SMILES | CC(C)CCCCCCNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C13H22ClN3/c1-11(2)7-5-3-4-6-8-15-13-16-9-12(14)10-17-13/h9-11H,3-8H2,1-2H3,(H,15,16,17) |
| InChIKey | MXOGSKUMAMPNAC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|