C22H24Cl2N4O4S2 — CID 87123360
[2-[2-(azepan-1-yl)ethylcarbamoylamino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate (PubChem CID 87123360) has the molecular formula C22H24Cl2N4O4S2 and a molecular weight of 543.50 g/mol. Its IUPAC name is [2-[2-(azepan-1-yl)ethylcarbamoylamino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate.
| Compound Name | [2-[2-(azepan-1-yl)ethylcarbamoylamino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87123360 |
| Molecular Formula | C22H24Cl2N4O4S2 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | [2-[2-(azepan-1-yl)ethylcarbamoylamino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate |
| SMILES | O=C(NCCN1CCCCCC1)Nc1nc2ccc(OS(=O)(=O)c3c(Cl)cccc3Cl)cc2s1 |
| InChI | InChI=1S/C22H24Cl2N4O4S2/c23-16-6-5-7-17(24)20(16)34(30,31)32-15-8-9-18-19(14-15)33-22(26-18)27-21(29)25-10-13-28-11-3-1-2-4-12-28/h5-9,14H,1-4,10-13H2,(H2,25,26,27,29) |
| InChIKey | UCXAVBJTWCQVCM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|