C23H24Cl2N4O4S2 — CID 163775751
[2-[[(2R)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]amino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate (PubChem CID 163775751) has the molecular formula C23H24Cl2N4O4S2 and a molecular weight of 555.51 g/mol. Its IUPAC name is [2-[[(2R)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]amino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate.
| Compound Name | [2-[[(2R)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]amino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 163775751 |
| Molecular Formula | C23H24Cl2N4O4S2 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | [2-[[(2R)-2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]amino]-1,3-benzothiazol-6-yl] 2,6-dichlorobenzenesulfonate |
| SMILES | O=C(Nc1nc2ccc(OS(=O)(=O)c3c(Cl)cccc3Cl)cc2s1)N1CCC[C@@H]1CN1CCCC1 |
| InChI | InChI=1S/C23H24Cl2N4O4S2/c24-17-6-3-7-18(25)21(17)35(31,32)33-16-8-9-19-20(13-16)34-22(26-19)27-23(30)29-12-4-5-15(29)14-28-10-1-2-11-28/h3,6-9,13,15H,1-2,4-5,10-12,14H2,(H,26,27,30)/t15-/m1/s1 |
| InChIKey | MKHPPIYPQVSWKK-OAHLLOKOSA-N |
| XLogP | 5.46 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|