C19H19N3O2S — CID 41327154
(2S)-N-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 41327154) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is (2S)-N-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 41327154 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2S)-N-(1,3-benzothiazol-2-yl)-2-(4-methoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-24-14-10-8-13(9-11-14)16-6-4-12-22(16)19(23)21-18-20-15-5-2-3-7-17(15)25-18/h2-3,5,7-11,16H,4,6,12H2,1H3,(H,20,21,23)/t16-/m0/s1 |
| InChIKey | BXIVIGSGGCLICN-INIZCTEOSA-N |
| XLogP | 4.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |