C15H11Cl2N3O2S — CID 4206727
1-(2,3-dichlorophenyl)-3-(6-methoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 4206727) has the molecular formula C15H11Cl2N3O2S and a molecular weight of 368.25 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(6-methoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(6-methoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 4206727 |
| Molecular Formula | C15H11Cl2N3O2S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(6-methoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1ccc2nc(NC(=O)Nc3cccc(Cl)c3Cl)sc2c1 |
| InChI | InChI=1S/C15H11Cl2N3O2S/c1-22-8-5-6-10-12(7-8)23-15(19-10)20-14(21)18-11-4-2-3-9(16)13(11)17/h2-7H,1H3,(H2,18,19,20,21) |
| InChIKey | HBVIYDCDPHODIV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |