C17H18ClN5O4S — CID 71569571
1-[6-[(2-chlorophenyl)methylsulfamoyl]-1H-benzimidazol-2-yl]-3-(2-hydroxyethyl)urea (PubChem CID 71569571) has the molecular formula C17H18ClN5O4S and a molecular weight of 423.88 g/mol. Its IUPAC name is 1-[6-[(2-chlorophenyl)methylsulfamoyl]-1H-benzimidazol-2-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[6-[(2-chlorophenyl)methylsulfamoyl]-1H-benzimidazol-2-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 71569571 |
| Molecular Formula | C17H18ClN5O4S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 1-[6-[(2-chlorophenyl)methylsulfamoyl]-1H-benzimidazol-2-yl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1nc2ccc(S(=O)(=O)NCc3ccccc3Cl)cc2[nH]1 |
| InChI | InChI=1S/C17H18ClN5O4S/c18-13-4-2-1-3-11(13)10-20-28(26,27)12-5-6-14-15(9-12)22-16(21-14)23-17(25)19-7-8-24/h1-6,9,20,24H,7-8,10H2,(H3,19,21,22,23,25) |
| InChIKey | VGWIDAGZBUGQIO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |