C15H13ClN2O3S — CID 110760517
N-[(2-chlorophenyl)methyl]-2-methyl-1,3-benzoxazole-5-sulfonamide (PubChem CID 110760517) has the molecular formula C15H13ClN2O3S and a molecular weight of 336.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-methyl-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-methyl-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760517 |
| Molecular Formula | C15H13ClN2O3S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-methyl-1,3-benzoxazole-5-sulfonamide |
| SMILES | Cc1nc2cc(S(=O)(=O)NCc3ccccc3Cl)ccc2o1 |
| InChI | InChI=1S/C15H13ClN2O3S/c1-10-18-14-8-12(6-7-15(14)21-10)22(19,20)17-9-11-4-2-3-5-13(11)16/h2-8,17H,9H2,1H3 |
| InChIKey | OIWLQKMMKSHOCQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |