C17H13ClNO5S- — CID 4319489
5-[(2-chlorophenyl)methylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 4319489) has the molecular formula C17H13ClNO5S- and a molecular weight of 378.81 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | 5-[(2-chlorophenyl)methylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4319489 |
| Molecular Formula | C17H13ClNO5S- |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 5-[(2-chlorophenyl)methylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)[O-])oc2ccc(S(=O)(=O)NCc3ccccc3Cl)cc12 |
| InChI | InChI=1S/C17H14ClNO5S/c1-10-13-8-12(6-7-15(13)24-16(10)17(20)21)25(22,23)19-9-11-4-2-3-5-14(11)18/h2-8,19H,9H2,1H3,(H,20,21)/p-1 |
| InChIKey | JRYCOSQWDCFEEW-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |