C18H18ClNO5S2 — CID 169244664
ethyl 5-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 169244664) has the molecular formula C18H18ClNO5S2 and a molecular weight of 427.93 g/mol. Its IUPAC name is ethyl 5-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 169244664 |
| Molecular Formula | C18H18ClNO5S2 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | ethyl 5-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)NCCc3ccc(Cl)s3)cc2c1C |
| InChI | InChI=1S/C18H18ClNO5S2/c1-3-24-18(21)17-11(2)14-10-13(5-6-15(14)25-17)27(22,23)20-9-8-12-4-7-16(19)26-12/h4-7,10,20H,3,8-9H2,1-2H3 |
| InChIKey | CNUNZZNDMLBTNT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |