C22H19NO5S — CID 169244642
ethyl 3-methyl-5-(naphthalen-2-ylsulfamoyl)-1-benzofuran-2-carboxylate (PubChem CID 169244642) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is ethyl 3-methyl-5-(naphthalen-2-ylsulfamoyl)-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-(naphthalen-2-ylsulfamoyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 169244642 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | ethyl 3-methyl-5-(naphthalen-2-ylsulfamoyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)Nc3ccc4ccccc4c3)cc2c1C |
| InChI | InChI=1S/C22H19NO5S/c1-3-27-22(24)21-14(2)19-13-18(10-11-20(19)28-21)29(25,26)23-17-9-8-15-6-4-5-7-16(15)12-17/h4-13,23H,3H2,1-2H3 |
| InChIKey | ARRXYKDYVBVZGI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |