C20H21NO6S — CID 169244621
ethyl 5-[2-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 169244621) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is ethyl 5-[2-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[2-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 169244621 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | ethyl 5-[2-(3-hydroxyphenyl)ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)NCCc3cccc(O)c3)cc2c1C |
| InChI | InChI=1S/C20H21NO6S/c1-3-26-20(23)19-13(2)17-12-16(7-8-18(17)27-19)28(24,25)21-10-9-14-5-4-6-15(22)11-14/h4-8,11-12,21-22H,3,9-10H2,1-2H3 |
| InChIKey | MIOJIFRFSUJFGJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |