C20H19NO6S — CID 169244624
ethyl 3-methyl-5-[(2-phenylacetyl)sulfamoyl]-1-benzofuran-2-carboxylate (PubChem CID 169244624) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is ethyl 3-methyl-5-[(2-phenylacetyl)sulfamoyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[(2-phenylacetyl)sulfamoyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 169244624 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | ethyl 3-methyl-5-[(2-phenylacetyl)sulfamoyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)NC(=O)Cc3ccccc3)cc2c1C |
| InChI | InChI=1S/C20H19NO6S/c1-3-26-20(23)19-13(2)16-12-15(9-10-17(16)27-19)28(24,25)21-18(22)11-14-7-5-4-6-8-14/h4-10,12H,3,11H2,1-2H3,(H,21,22) |
| InChIKey | ISJPVMLYSZPHFJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |