About ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate
ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 46381103) has the molecular formula C25H20N2O5S2
and a molecular weight of 492.58 g/mol. Its IUPAC name is ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 46381103 |
| Molecular Formula | C25H20N2O5S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)Nc3ccc(-c4nc5ccccc5s4)cc3)cc2c1C |
| InChI | InChI=1S/C25H20N2O5S2/c1-3-31-25(28)23-15(2)19-14-18(12-13-21(19)32-23)34(29,30)27-17-10-8-16(9-11-17)24-26-20-6-4-5-7-22(20)33-24/h4-14,27H,3H2,1-2H3 |
| InChIKey | OCRZXBWOXINPGG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (CID 46381103) is ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate is CCOC(=O)c1oc2ccc(S(=O)(=O)Nc3ccc(-c4nc5ccccc5s4)cc3)cc2c1C.
What is the InChIKey of ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is OCRZXBWOXINPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O5S2/c1-3-31-25(28)23-15(2)19-14-18(12-13-21(19)32-23)34(29,30)27-17-10-8-16(9-11-17)24-26-20-6-4-5-7-22(20)33-24/h4-14,27H,3H2,1-2H3.
What are the key properties of ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate?
ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 492.58 g/mol, XLogP of 6.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 46381103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).