C22H18N2O4S2 — CID 58937065
5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-2-ethylbenzoic acid (PubChem CID 58937065) has the molecular formula C22H18N2O4S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-2-ethylbenzoic acid.
| Compound Name | 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-2-ethylbenzoic acid |
|---|---|
| PubChem CID | 58937065 |
| Molecular Formula | C22H18N2O4S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 5-[[4-(1,3-benzothiazol-2-yl)phenyl]sulfamoyl]-2-ethylbenzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(-c3nc4ccccc4s3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C22H18N2O4S2/c1-2-14-9-12-17(13-18(14)22(25)26)30(27,28)24-16-10-7-15(8-11-16)21-23-19-5-3-4-6-20(19)29-21/h3-13,24H,2H2,1H3,(H,25,26) |
| InChIKey | DZZHVWDXXRRNAN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |