C23H21N3O3S2 — CID 35613501
N-[3-(1,3-benzothiazol-2-yl)phenyl]-5-(ethylsulfamoyl)-2-methylbenzamide (PubChem CID 35613501) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-5-(ethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-5-(ethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 35613501 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-5-(ethylsulfamoyl)-2-methylbenzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)Nc2cccc(-c3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-3-24-31(28,29)18-12-11-15(2)19(14-18)22(27)25-17-8-6-7-16(13-17)23-26-20-9-4-5-10-21(20)30-23/h4-14,24H,3H2,1-2H3,(H,25,27) |
| InChIKey | AWDOVBVHUVAPGJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |