C23H17N3O3S2 — CID 34313277
N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 34313277) has the molecular formula C23H17N3O3S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 34313277 |
| Molecular Formula | C23H17N3O3S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C23H17N3O3S2/c1-2-14-24-31(28,29)19-12-10-16(11-13-19)22(27)25-18-7-5-6-17(15-18)23-26-20-8-3-4-9-21(20)30-23/h1,3-13,15,24H,14H2,(H,25,27) |
| InChIKey | VAANALMWHDBYAE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|