C16H20N2O5S — CID 124725014
ethyl 3-methyl-5-[[(3S)-pyrrolidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate (PubChem CID 124725014) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[(3S)-pyrrolidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[(3S)-pyrrolidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 124725014 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 3-methyl-5-[[(3S)-pyrrolidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)N[C@H]3CCNC3)cc2c1C |
| InChI | InChI=1S/C16H20N2O5S/c1-3-22-16(19)15-10(2)13-8-12(4-5-14(13)23-15)24(20,21)18-11-6-7-17-9-11/h4-5,8,11,17-18H,3,6-7,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | AVWYJQZQPGAUKC-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |