C17H22N2O5S — CID 120876450
ethyl 3-methyl-5-[[(3R)-piperidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate (PubChem CID 120876450) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is ethyl 3-methyl-5-[[(3R)-piperidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[[(3R)-piperidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 120876450 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl 3-methyl-5-[[(3R)-piperidin-3-yl]sulfamoyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)N[C@@H]3CCCNC3)cc2c1C |
| InChI | InChI=1S/C17H22N2O5S/c1-3-23-17(20)16-11(2)14-9-13(6-7-15(14)24-16)25(21,22)19-12-5-4-8-18-10-12/h6-7,9,12,18-19H,3-5,8,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | HMYXICLDJMJHBH-GFCCVEGCSA-N |
| XLogP | 1.95 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |