About ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine
ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine (PubChem CID 145274258) has the molecular formula C18H23NO4
and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine.
Molecular Properties
| Compound Name | ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine |
| PubChem CID | 145274258 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine |
| SMILES | CCOC(=O)c1oc2ccc(C=O)cc2c1C.CNC1CCC1 |
| InChI | InChI=1S/C13H12O4.C5H11N/c1-3-16-13(15)12-8(2)10-6-9(7-14)4-5-11(10)17-12;1-6-5-3-2-4-5/h4-7H,3H2,1-2H3;5-6H,2-4H2,1H3 |
| InChIKey | AGPPQQHLTAKLRN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine?
The IUPAC name of ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine (CID 145274258) is ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine.
What is the SMILES notation for ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine?
The canonical SMILES for ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine is CCOC(=O)c1oc2ccc(C=O)cc2c1C.CNC1CCC1.
What is the InChIKey of ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine?
The InChIKey is AGPPQQHLTAKLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4.C5H11N/c1-3-16-13(15)12-8(2)10-6-9(7-14)4-5-11(10)17-12;1-6-5-3-2-4-5/h4-7H,3H2,1-2H3;5-6H,2-4H2,1H3.
What are the key properties of ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine?
ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine has a molecular weight of 317.39 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-formyl-3-methyl-1-benzofuran-2-carboxylate;N-methylcyclobutanamine is sourced from PubChem (CID 145274258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).