C17H23ClN2O5S — CID 120874558
ethyl 3-methyl-5-(piperidin-3-ylsulfamoyl)-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 120874558) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is ethyl 3-methyl-5-(piperidin-3-ylsulfamoyl)-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | ethyl 3-methyl-5-(piperidin-3-ylsulfamoyl)-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120874558 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethyl 3-methyl-5-(piperidin-3-ylsulfamoyl)-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)NC3CCCNC3)cc2c1C.Cl |
| InChI | InChI=1S/C17H22N2O5S.ClH/c1-3-23-17(20)16-11(2)14-9-13(6-7-15(14)24-16)25(21,22)19-12-5-4-8-18-10-12;/h6-7,9,12,18-19H,3-5,8,10H2,1-2H3;1H |
| InChIKey | QRIYTXWBLIQEGK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |