C14H10Cl2N4O — CID 107653951
1-(1H-benzimidazol-2-yl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107653951) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107653951 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H10Cl2N4O/c15-8-5-9(16)7-10(6-8)17-14(21)20-13-18-11-3-1-2-4-12(11)19-13/h1-7H,(H3,17,18,19,20,21) |
| InChIKey | UKDXPEKRGNRXKS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |