C9H7Cl2N5O — CID 107653950
1-(3,5-dichlorophenyl)-3-(1H-1,2,4-triazol-5-yl)urea (PubChem CID 107653950) has the molecular formula C9H7Cl2N5O and a molecular weight of 272.10 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(1H-1,2,4-triazol-5-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(1H-1,2,4-triazol-5-yl)urea |
|---|---|
| PubChem CID | 107653950 |
| Molecular Formula | C9H7Cl2N5O |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(1H-1,2,4-triazol-5-yl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C9H7Cl2N5O/c10-5-1-6(11)3-7(2-5)14-9(17)15-8-12-4-13-16-8/h1-4H,(H3,12,13,14,15,16,17) |
| InChIKey | VXCWYYZWWVDHPV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |