C11H10ClN5O2 — CID 108511819
N-(5-chloro-2-methylphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide (PubChem CID 108511819) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide |
|---|---|
| PubChem CID | 108511819 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C11H10ClN5O2/c1-6-2-3-7(12)4-8(6)15-9(18)10(19)16-11-13-5-14-17-11/h2-5H,1H3,(H,15,18)(H2,13,14,16,17,19) |
| InChIKey | BJAUBJXTUODPTG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|