C14H10Cl2N4O2 — CID 48743188
1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea (PubChem CID 48743188) has the molecular formula C14H10Cl2N4O2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 48743188 |
| Molecular Formula | C14H10Cl2N4O2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H10Cl2N4O2/c15-7-3-8(16)5-10(4-7)18-13(21)17-9-1-2-11-12(6-9)20-14(22)19-11/h1-6H,(H2,17,18,21)(H2,19,20,22) |
| InChIKey | WMTWMWFRPHURMN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |