C8H9N5O2 — CID 115192410
1-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea (PubChem CID 115192410) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 1-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea.
| Compound Name | 1-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 115192410 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-amino-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
| SMILES | NNC(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C8H9N5O2/c9-13-8(15)10-4-1-2-5-6(3-4)12-7(14)11-5/h1-3H,9H2,(H2,10,13,15)(H2,11,12,14) |
| InChIKey | WVOLIAGXBWEBAO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|