C10H9N3O4 — CID 115142201
methyl 2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]acetate (PubChem CID 115142201) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is methyl 2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]acetate.
| Compound Name | methyl 2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]acetate |
|---|---|
| PubChem CID | 115142201 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | methyl 2-oxo-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]acetate |
| SMILES | COC(=O)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H9N3O4/c1-17-9(15)8(14)11-5-2-3-6-7(4-5)13-10(16)12-6/h2-4H,1H3,(H,11,14)(H2,12,13,16) |
| InChIKey | FQGNOSVJLVSTRC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|