C10H8F3N5O2 — CID 115565023
1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 115565023) has the molecular formula C10H8F3N5O2 and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 115565023 |
| Molecular Formula | C10H8F3N5O2 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C10H8F3N5O2/c11-10(12,13)20-7-3-1-6(2-4-7)16-9(19)17-8-14-5-15-18-8/h1-5H,(H3,14,15,16,17,18,19) |
| InChIKey | KFVUDDOBXVMNQA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |