C11H8F3N3O2 — CID 723660
N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 723660) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 723660 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1ccn[nH]1 |
| InChI | InChI=1S/C11H8F3N3O2/c12-11(13,14)19-8-3-1-7(2-4-8)16-10(18)9-5-6-15-17-9/h1-6H,(H,15,17)(H,16,18) |
| InChIKey | TXLNVQOPWGVRFO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |