C11H7F3IN3O2 — CID 19479801
4-iodo-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 19479801) has the molecular formula C11H7F3IN3O2 and a molecular weight of 397.09 g/mol. Its IUPAC name is 4-iodo-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-iodo-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479801 |
| Molecular Formula | C11H7F3IN3O2 |
| Molecular Weight | 397.09 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | 4-iodo-N-[4-(trifluoromethoxy)phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1[nH]ncc1I |
| InChI | InChI=1S/C11H7F3IN3O2/c12-11(13,14)20-7-3-1-6(2-4-7)17-10(19)9-8(15)5-16-18-9/h1-5H,(H,16,18)(H,17,19) |
| InChIKey | ZIHCKMPQXFLLLV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.09 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|