C16H10F6N4O — CID 166873254
1-(1H-benzimidazol-2-yl)-3-[3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 166873254) has the molecular formula C16H10F6N4O and a molecular weight of 388.27 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-[3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-[3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 166873254 |
| Molecular Formula | C16H10F6N4O |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H10F6N4O/c17-15(18,19)8-5-9(16(20,21)22)7-10(6-8)23-14(27)26-13-24-11-3-1-2-4-12(11)25-13/h1-7H,(H3,23,24,25,26,27) |
| InChIKey | MSPTWANIJSXFJY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |