C12H9F3N4O3 — CID 3319514
1-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 3319514) has the molecular formula C12H9F3N4O3 and a molecular weight of 314.22 g/mol. Its IUPAC name is 1-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3319514 |
| Molecular Formula | C12H9F3N4O3 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1nc(O)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H9F3N4O3/c13-12(14,15)6-2-1-3-7(4-6)16-11(22)19-10-17-8(20)5-9(21)18-10/h1-5H,(H4,16,17,18,19,20,21,22) |
| InChIKey | FPZVLDNIQTVZBN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |