C12H9F4N3O3 — CID 139976279
4-hydroxy-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1H-pyrimidin-6-one (PubChem CID 139976279) has the molecular formula C12H9F4N3O3 and a molecular weight of 319.21 g/mol. Its IUPAC name is 4-hydroxy-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 139976279 |
| Molecular Formula | C12H9F4N3O3 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-hydroxy-2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(Nc2cccc(OC(F)(F)C(F)F)c2)[nH]1 |
| InChI | InChI=1S/C12H9F4N3O3/c13-10(14)12(15,16)22-7-3-1-2-6(4-7)17-11-18-8(20)5-9(21)19-11/h1-5,10H,(H3,17,18,19,20,21) |
| InChIKey | OJRHHIZAUXYPMQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|