C11H8F3N3O3 — CID 139976239
4-hydroxy-2-[4-(trifluoromethoxy)anilino]-1H-pyrimidin-6-one (PubChem CID 139976239) has the molecular formula C11H8F3N3O3 and a molecular weight of 287.20 g/mol. Its IUPAC name is 4-hydroxy-2-[4-(trifluoromethoxy)anilino]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-[4-(trifluoromethoxy)anilino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 139976239 |
| Molecular Formula | C11H8F3N3O3 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-hydroxy-2-[4-(trifluoromethoxy)anilino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(Nc2ccc(OC(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C11H8F3N3O3/c12-11(13,14)20-7-3-1-6(2-4-7)15-10-16-8(18)5-9(19)17-10/h1-5H,(H3,15,16,17,18,19) |
| InChIKey | PJQHOMFSPQGCFK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |