C20H17F4N5O4 — CID 139686417
(2-hydroxyethylamino) 4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]pyridine-2-carboxylate (PubChem CID 139686417) has the molecular formula C20H17F4N5O4 and a molecular weight of 467.38 g/mol. Its IUPAC name is (2-hydroxyethylamino) 4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]pyridine-2-carboxylate.
| Compound Name | (2-hydroxyethylamino) 4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139686417 |
| Molecular Formula | C20H17F4N5O4 |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (2-hydroxyethylamino) 4-[2-[3-(1,1,2,2-tetrafluoroethoxy)anilino]pyrimidin-4-yl]pyridine-2-carboxylate |
| SMILES | O=C(ONCCO)c1cc(-c2ccnc(Nc3cccc(OC(F)(F)C(F)F)c3)n2)ccn1 |
| InChI | InChI=1S/C20H17F4N5O4/c21-18(22)20(23,24)32-14-3-1-2-13(11-14)28-19-26-7-5-15(29-19)12-4-6-25-16(10-12)17(31)33-27-8-9-30/h1-7,10-11,18,27,30H,8-9H2,(H,26,28,29) |
| InChIKey | JAAGLSLZQLRTOJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|