C21H22ClN5O2 — CID 25122224
4-[2-(3-chloroanilino)pyrimidin-4-yl]-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide (PubChem CID 25122224) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-[2-(3-chloroanilino)pyrimidin-4-yl]-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide.
| Compound Name | 4-[2-(3-chloroanilino)pyrimidin-4-yl]-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25122224 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[2-(3-chloroanilino)pyrimidin-4-yl]-N-(1-methoxybutan-2-yl)pyridine-2-carboxamide |
| SMILES | CCC(COC)NC(=O)c1cc(-c2ccnc(Nc3cccc(Cl)c3)n2)ccn1 |
| InChI | InChI=1S/C21H22ClN5O2/c1-3-16(13-29-2)25-20(28)19-11-14(7-9-23-19)18-8-10-24-21(27-18)26-17-6-4-5-15(22)12-17/h4-12,16H,3,13H2,1-2H3,(H,25,28)(H,24,26,27) |
| InChIKey | QXWYRWRYFKSBKV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |