C8H6F3N3O2S — CID 55213553
N-(1H-benzimidazol-2-yl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 55213553) has the molecular formula C8H6F3N3O2S and a molecular weight of 265.22 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 55213553 |
| Molecular Formula | C8H6F3N3O2S |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2[nH]1)C(F)(F)F |
| InChI | InChI=1S/C8H6F3N3O2S/c9-8(10,11)17(15,16)14-7-12-5-3-1-2-4-6(5)13-7/h1-4H,(H2,12,13,14) |
| InChIKey | SZAXRFLZFKVHKY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |