C10H14N4O2S — CID 63562812
N-(1H-benzimidazol-2-yl)-2-(methylamino)ethanesulfonamide (PubChem CID 63562812) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-2-(methylamino)ethanesulfonamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-2-(methylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 63562812 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-2-(methylamino)ethanesulfonamide |
| SMILES | CNCCS(=O)(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H14N4O2S/c1-11-6-7-17(15,16)14-10-12-8-4-2-3-5-9(8)13-10/h2-5,11H,6-7H2,1H3,(H2,12,13,14) |
| InChIKey | ZOMAIZSQZLEPIT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |