C16H12F3N3O2 — CID 130366252
2-(1H-benzimidazol-2-ylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 130366252) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-(1H-benzimidazol-2-ylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 130366252 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(Nc1nc2ccccc2[nH]1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F3N3O2/c17-16(18,19)10-5-3-4-9(8-10)13(14(23)24)22-15-20-11-6-1-2-7-12(11)21-15/h1-8,13H,(H,23,24)(H2,20,21,22) |
| InChIKey | KFNROAJRMDFNGD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |