C16H13N5O — CID 171803128
1-(1H-benzimidazol-2-yl)-3-[2-(cyanomethyl)phenyl]urea (PubChem CID 171803128) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-[2-(cyanomethyl)phenyl]urea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-[2-(cyanomethyl)phenyl]urea |
|---|---|
| PubChem CID | 171803128 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-[2-(cyanomethyl)phenyl]urea |
| SMILES | N#CCc1ccccc1NC(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H13N5O/c17-10-9-11-5-1-2-6-12(11)20-16(22)21-15-18-13-7-3-4-8-14(13)19-15/h1-8H,9H2,(H3,18,19,20,21,22) |
| InChIKey | YYRLDLGTFOQUSW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |